C30H40O10S2 — CID 139190114
(2R,4aR,6S,8aR)-2-(benzenesulfonyl)-6-methoxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 139190114) has the molecular formula C30H40O10S2 and a molecular weight of 624.77 g/mol. Its IUPAC name is (2R,4aR,6S,8aR)-2-(benzenesulfonyl)-6-methoxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (2R,4aR,6S,8aR)-2-(benzenesulfonyl)-6-methoxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 139190114 |
| Molecular Formula | C30H40O10S2 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | (2R,4aR,6S,8aR)-2-(benzenesulfonyl)-6-methoxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | CO[C@@H]1CC[C@H]2O[C@H](S(=O)(=O)c3ccccc3)CC[C@H]2O1.CO[C@@H]1CC[C@H]2O[C@H](S(=O)(=O)c3ccccc3)CC[C@H]2O1 |
| InChI | InChI=1S/2C15H20O5S/c2*1-18-14-9-7-13-12(19-14)8-10-15(20-13)21(16,17)11-5-3-2-4-6-11/h2*2-6,12-15H,7-10H2,1H3/t2*12-,13-,14+,15-/m11/s1 |
| InChIKey | UUEYNHQOLHLSDZ-ADQYSVBOSA-N |
| XLogP | 4.23 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |