C25H32O8S2 — CID 62707369
[(4aS,5S,7R,8R,8aR)-2,3-dimethoxy-2,3,5-trimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] phenylmethanesulfonate (PubChem CID 62707369) has the molecular formula C25H32O8S2 and a molecular weight of 524.66 g/mol. Its IUPAC name is [(4aS,5S,7R,8R,8aR)-2,3-dimethoxy-2,3,5-trimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] phenylmethanesulfonate.
| Compound Name | [(4aS,5S,7R,8R,8aR)-2,3-dimethoxy-2,3,5-trimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 62707369 |
| Molecular Formula | C25H32O8S2 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | [(4aS,5S,7R,8R,8aR)-2,3-dimethoxy-2,3,5-trimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] phenylmethanesulfonate |
| SMILES | COC1(C)O[C@@H]2[C@@H](OC1(C)OC)[C@H](C)O[C@H](Sc1ccccc1)[C@@H]2OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H32O8S2/c1-17-20-21(32-25(3,29-5)24(2,28-4)31-20)22(23(30-17)34-19-14-10-7-11-15-19)33-35(26,27)16-18-12-8-6-9-13-18/h6-15,17,20-23H,16H2,1-5H3/t17-,20-,21+,22+,23+,24?,25?/m0/s1 |
| InChIKey | PQZNXSKUVZSZSC-KZOKUWKISA-N |
| XLogP | 3.95 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|