C20H22O6S2 — CID 25198159
(2R,4aR,6R,8aR)-2,6-bis(benzenesulfonyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 25198159) has the molecular formula C20H22O6S2 and a molecular weight of 422.52 g/mol. Its IUPAC name is (2R,4aR,6R,8aR)-2,6-bis(benzenesulfonyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (2R,4aR,6R,8aR)-2,6-bis(benzenesulfonyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 25198159 |
| Molecular Formula | C20H22O6S2 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (2R,4aR,6R,8aR)-2,6-bis(benzenesulfonyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1CC[C@H]2O[C@H](S(=O)(=O)c3ccccc3)CC[C@H]2O1 |
| InChI | InChI=1S/C20H22O6S2/c21-27(22,15-7-3-1-4-8-15)19-13-11-18-17(25-19)12-14-20(26-18)28(23,24)16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-,19-,20-/m1/s1 |
| InChIKey | VNMYYWYVVSSPDH-UAFMIMERSA-N |
| XLogP | 2.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |