C18H26O4S2 — CID 162407445
2-[2-(benzenesulfonyl)-2-cyclohexylsulfanylethyl]-1,4-dioxane (PubChem CID 162407445) has the molecular formula C18H26O4S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-2-cyclohexylsulfanylethyl]-1,4-dioxane.
| Compound Name | 2-[2-(benzenesulfonyl)-2-cyclohexylsulfanylethyl]-1,4-dioxane |
|---|---|
| PubChem CID | 162407445 |
| Molecular Formula | C18H26O4S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-2-cyclohexylsulfanylethyl]-1,4-dioxane |
| SMILES | O=S(=O)(c1ccccc1)C(CC1COCCO1)SC1CCCCC1 |
| InChI | InChI=1S/C18H26O4S2/c19-24(20,17-9-5-2-6-10-17)18(13-15-14-21-11-12-22-15)23-16-7-3-1-4-8-16/h2,5-6,9-10,15-16,18H,1,3-4,7-8,11-14H2 |
| InChIKey | OTJYTXQZTCUUEP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |