C24H30O2S2 — CID 101265138
(3S,4aR,7R,8aS)-2,2,6,6-tetramethyl-3,7-bis(phenylsulfanyl)-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran (PubChem CID 101265138) has the molecular formula C24H30O2S2 and a molecular weight of 414.64 g/mol. Its IUPAC name is (3S,4aR,7R,8aS)-2,2,6,6-tetramethyl-3,7-bis(phenylsulfanyl)-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran.
| Compound Name | (3S,4aR,7R,8aS)-2,2,6,6-tetramethyl-3,7-bis(phenylsulfanyl)-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 101265138 |
| Molecular Formula | C24H30O2S2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (3S,4aR,7R,8aS)-2,2,6,6-tetramethyl-3,7-bis(phenylsulfanyl)-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran |
| SMILES | CC1(C)O[C@H]2C[C@@H](Sc3ccccc3)C(C)(C)O[C@@H]2C[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C24H30O2S2/c1-23(2)21(27-17-11-7-5-8-12-17)15-20-19(25-23)16-22(24(3,4)26-20)28-18-13-9-6-10-14-18/h5-14,19-22H,15-16H2,1-4H3/t19-,20+,21-,22+ |
| InChIKey | AMULZUUGFKODTH-COPRSSIGSA-N |
| XLogP | 6.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |