C23H26O3S2 — CID 10501947
(1S,3R,8R,10S)-9,9-bis(phenylsulfanyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecane (PubChem CID 10501947) has the molecular formula C23H26O3S2 and a molecular weight of 414.59 g/mol. Its IUPAC name is (1S,3R,8R,10S)-9,9-bis(phenylsulfanyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (1S,3R,8R,10S)-9,9-bis(phenylsulfanyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 10501947 |
| Molecular Formula | C23H26O3S2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (1S,3R,8R,10S)-9,9-bis(phenylsulfanyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecane |
| SMILES | c1ccc(SC2(Sc3ccccc3)[C@@H]3OCCC[C@H]3O[C@H]3CCCO[C@@H]32)cc1 |
| InChI | InChI=1S/C23H26O3S2/c1-3-9-17(10-4-1)27-23(28-18-11-5-2-6-12-18)21-19(13-7-15-24-21)26-20-14-8-16-25-22(20)23/h1-6,9-12,19-22H,7-8,13-16H2/t19-,20+,21-,22+ |
| InChIKey | QQFWHZZASATGAG-COPRSSIGSA-N |
| XLogP | 5.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|