C20H22O2S2 — CID 25198004
(2R,4aR,8aR)-2,6-bis(phenylsulfanyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 25198004) has the molecular formula C20H22O2S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (2R,4aR,8aR)-2,6-bis(phenylsulfanyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (2R,4aR,8aR)-2,6-bis(phenylsulfanyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 25198004 |
| Molecular Formula | C20H22O2S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (2R,4aR,8aR)-2,6-bis(phenylsulfanyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | c1ccc(SC2CC[C@H]3O[C@H](Sc4ccccc4)CC[C@H]3O2)cc1 |
| InChI | InChI=1S/C20H22O2S2/c1-3-7-15(8-4-1)23-19-13-11-18-17(21-19)12-14-20(22-18)24-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-,19-,20?/m1/s1 |
| InChIKey | ZONWUFQROHRJIM-SDWZKWEYSA-N |
| XLogP | 5.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |