C15H22O6S — CID 134878455
(2R,3S,4R,6R)-6-(benzenesulfonyl)-3,4-dimethoxy-2-(methoxymethyl)oxane (PubChem CID 134878455) has the molecular formula C15H22O6S and a molecular weight of 330.40 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-(benzenesulfonyl)-3,4-dimethoxy-2-(methoxymethyl)oxane.
| Compound Name | (2R,3S,4R,6R)-6-(benzenesulfonyl)-3,4-dimethoxy-2-(methoxymethyl)oxane |
|---|---|
| PubChem CID | 134878455 |
| Molecular Formula | C15H22O6S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (2R,3S,4R,6R)-6-(benzenesulfonyl)-3,4-dimethoxy-2-(methoxymethyl)oxane |
| SMILES | COC[C@H]1O[C@H](S(=O)(=O)c2ccccc2)C[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C15H22O6S/c1-18-10-13-15(20-3)12(19-2)9-14(21-13)22(16,17)11-7-5-4-6-8-11/h4-8,12-15H,9-10H2,1-3H3/t12-,13-,14-,15+/m1/s1 |
| InChIKey | XUSJWRVMWCLRLS-TUVASFSCSA-N |
| XLogP | 1.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |