C33H36O6S2 — CID 10579352
(4R,6S,7R,11R,15S)-15-[(S)-hydroxy(phenyl)methyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one (PubChem CID 10579352) has the molecular formula C33H36O6S2 and a molecular weight of 592.78 g/mol. Its IUPAC name is (4R,6S,7R,11R,15S)-15-[(S)-hydroxy(phenyl)methyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one.
| Compound Name | (4R,6S,7R,11R,15S)-15-[(S)-hydroxy(phenyl)methyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
|---|---|
| PubChem CID | 10579352 |
| Molecular Formula | C33H36O6S2 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | (4R,6S,7R,11R,15S)-15-[(S)-hydroxy(phenyl)methyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
| SMILES | O=C1O[C@]2(CCC[C@H](CSc3ccccc3)O2)[C@@]2(CCC[C@H](CSc3ccccc3)O2)O[C@H]1[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C33H36O6S2/c34-29(24-12-4-1-5-13-24)30-31(35)39-33(21-11-15-26(37-33)23-41-28-18-8-3-9-19-28)32(38-30)20-10-14-25(36-32)22-40-27-16-6-2-7-17-27/h1-9,12-13,16-19,25-26,29-30,34H,10-11,14-15,20-23H2/t25-,26-,29+,30+,32-,33-/m1/s1 |
| InChIKey | HEBRHIQLGBOBGI-GYQNTWPVSA-N |
| XLogP | 6.78 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |