C39H50O6S2Si — CID 10699951
(4R,6S,7R,11R,15S)-15-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one (PubChem CID 10699951) has the molecular formula C39H50O6S2Si and a molecular weight of 707.04 g/mol. Its IUPAC name is (4R,6S,7R,11R,15S)-15-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one.
| Compound Name | (4R,6S,7R,11R,15S)-15-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
|---|---|
| PubChem CID | 10699951 |
| Molecular Formula | C39H50O6S2Si |
| Molecular Weight | 707.04 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | (4R,6S,7R,11R,15S)-15-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@@H]1O[C@]2(CCC[C@H](CSc3ccccc3)O2)[C@@]2(CCC[C@H](CSc3ccccc3)O2)OC1=O |
| InChI | InChI=1S/C39H50O6S2Si/c1-37(2,3)48(4,5)45-34(29-17-9-6-10-18-29)35-36(40)44-39(26-16-20-31(42-39)28-47-33-23-13-8-14-24-33)38(43-35)25-15-19-30(41-38)27-46-32-21-11-7-12-22-32/h6-14,17-18,21-24,30-31,34-35H,15-16,19-20,25-28H2,1-5H3/t30-,31-,34+,35+,38-,39-/m1/s1 |
| InChIKey | JKHQGLYAZQIFRZ-VIZZXJDCSA-N |
| XLogP | 9.81 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.04 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|