C41H50O9SSi — CID 11061636
2-(benzenesulfonyl)-1-[(4S,5S)-5-[(S)-[tert-butyl(diphenyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trimethoxybutan-1-one (PubChem CID 11061636) has the molecular formula C41H50O9SSi and a molecular weight of 747.00 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(4S,5S)-5-[(S)-[tert-butyl(diphenyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trimethoxybutan-1-one.
| Compound Name | 2-(benzenesulfonyl)-1-[(4S,5S)-5-[(S)-[tert-butyl(diphenyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trimethoxybutan-1-one |
|---|---|
| PubChem CID | 11061636 |
| Molecular Formula | C41H50O9SSi |
| Molecular Weight | 747.00 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(4S,5S)-5-[(S)-[tert-butyl(diphenyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trimethoxybutan-1-one |
| SMILES | COC(CC(C(=O)[C@H]1OC(C)(C)O[C@@H]1[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1)S(=O)(=O)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C41H50O9SSi/c1-39(2,3)52(32-25-17-11-18-26-32,33-27-19-12-20-28-33)50-36(30-21-13-9-14-22-30)38-37(48-40(4,5)49-38)35(42)34(29-41(45-6,46-7)47-8)51(43,44)31-23-15-10-16-24-31/h9-28,34,36-38H,29H2,1-8H3/t34?,36-,37+,38+/m0/s1 |
| InChIKey | ZUISVLCVDQYLNE-IJHHESBISA-N |
| XLogP | 6.22 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.00 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|