C34H42O5Si — CID 135014739
ethyl (E)-4-[(4R,5S)-5-[(R)-[tert-butyl(diphenyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoate (PubChem CID 135014739) has the molecular formula C34H42O5Si and a molecular weight of 558.79 g/mol. Its IUPAC name is ethyl (E)-4-[(4R,5S)-5-[(R)-[tert-butyl(diphenyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoate.
| Compound Name | ethyl (E)-4-[(4R,5S)-5-[(R)-[tert-butyl(diphenyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoate |
|---|---|
| PubChem CID | 135014739 |
| Molecular Formula | C34H42O5Si |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | ethyl (E)-4-[(4R,5S)-5-[(R)-[tert-butyl(diphenyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoate |
| SMILES | CCOC(=O)C/C=C/[C@H]1OC(C)(C)O[C@@H]1[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C34H42O5Si/c1-7-36-30(35)25-17-24-29-32(38-34(5,6)37-29)31(26-18-11-8-12-19-26)39-40(33(2,3)4,27-20-13-9-14-21-27)28-22-15-10-16-23-28/h8-24,29,31-32H,7,25H2,1-6H3/b24-17+/t29-,31-,32+/m1/s1 |
| InChIKey | PSEBULXZFGCTRV-HJOMJSQWSA-N |
| XLogP | 6.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|