C40H54O6S2Si — CID 10628687
[(4R,6S,7S,11R,14R,15S)-14-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-yl]methanol (PubChem CID 10628687) has the molecular formula C40H54O6S2Si and a molecular weight of 723.09 g/mol. Its IUPAC name is [(4R,6S,7S,11R,14R,15S)-14-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-yl]methanol.
| Compound Name | [(4R,6S,7S,11R,14R,15S)-14-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-yl]methanol |
|---|---|
| PubChem CID | 10628687 |
| Molecular Formula | C40H54O6S2Si |
| Molecular Weight | 723.09 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | [(4R,6S,7S,11R,14R,15S)-14-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@@H]1O[C@]2(CCC[C@H](CSc3ccccc3)O2)[C@@]2(CCC[C@H](CSc3ccccc3)O2)O[C@H]1CO |
| InChI | InChI=1S/C40H54O6S2Si/c1-38(2,3)49(4,5)46-36(30-17-9-6-10-18-30)37-35(27-41)44-39(25-15-19-31(42-39)28-47-33-21-11-7-12-22-33)40(45-37)26-16-20-32(43-40)29-48-34-23-13-8-14-24-34/h6-14,17-18,21-24,31-32,35-37,41H,15-16,19-20,25-29H2,1-5H3/t31-,32-,35+,36+,37-,39-,40-/m1/s1 |
| InChIKey | JOQHIHQIGYUQCC-YSULKAOFSA-N |
| XLogP | 9.64 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.09 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|