C37H46O8SSi — CID 45273853
[(4aR,6S,7R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] prop-2-enyl carbonate (PubChem CID 45273853) has the molecular formula C37H46O8SSi and a molecular weight of 678.92 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] prop-2-enyl carbonate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 45273853 |
| Molecular Formula | C37H46O8SSi |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-7-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)O[C@@H]1[C@@H](O[C@H](CSc2ccccc2)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C37H46O8SSi/c1-7-23-39-36(38)44-32-31-29(24-40-34(43-31)27-19-13-9-14-20-27)42-35(45-47(5,6)37(2,3)4)33(32)41-30(26-17-11-8-12-18-26)25-46-28-21-15-10-16-22-28/h7-22,29-35H,1,23-25H2,2-6H3/t29-,30-,31-,32+,33-,34?,35+/m1/s1 |
| InChIKey | VVQHCAVDALINAW-ILBLFFQRSA-N |
| XLogP | 8.47 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|