C40H52O5S2Si — CID 10723442
tert-butyl-dimethyl-[(S)-[(4R,6S,7R,11R,15S)-14-methylidene-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-yl]-phenylmethoxy]silane (PubChem CID 10723442) has the molecular formula C40H52O5S2Si and a molecular weight of 705.07 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(S)-[(4R,6S,7R,11R,15S)-14-methylidene-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-yl]-phenylmethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(S)-[(4R,6S,7R,11R,15S)-14-methylidene-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-yl]-phenylmethoxy]silane |
|---|---|
| PubChem CID | 10723442 |
| Molecular Formula | C40H52O5S2Si |
| Molecular Weight | 705.07 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | tert-butyl-dimethyl-[(S)-[(4R,6S,7R,11R,15S)-14-methylidene-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-yl]-phenylmethoxy]silane |
| SMILES | C=C1O[C@]2(CCC[C@H](CSc3ccccc3)O2)[C@@]2(CCC[C@H](CSc3ccccc3)O2)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C40H52O5S2Si/c1-30-36(37(31-18-10-7-11-19-31)45-48(5,6)38(2,3)4)44-40(27-17-21-33(43-40)29-47-35-24-14-9-15-25-35)39(41-30)26-16-20-32(42-39)28-46-34-22-12-8-13-23-34/h7-15,18-19,22-25,32-33,36-37H,1,16-17,20-21,26-29H2,2-6H3/t32-,33-,36-,37+,39+,40-/m1/s1 |
| InChIKey | LZNTWXQAUPTJED-LMZVQETESA-N |
| XLogP | 10.79 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.07 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|