C25H30O7S2 — CID 11713150
propan-2-yl (2S,4R,5R,6R)-4-acetyloxy-5-hydroxy-6-[(1R)-1-hydroxy-2,2-bis(phenylsulfanyl)ethyl]oxane-2-carboxylate (PubChem CID 11713150) has the molecular formula C25H30O7S2 and a molecular weight of 506.64 g/mol. Its IUPAC name is propan-2-yl (2S,4R,5R,6R)-4-acetyloxy-5-hydroxy-6-[(1R)-1-hydroxy-2,2-bis(phenylsulfanyl)ethyl]oxane-2-carboxylate.
| Compound Name | propan-2-yl (2S,4R,5R,6R)-4-acetyloxy-5-hydroxy-6-[(1R)-1-hydroxy-2,2-bis(phenylsulfanyl)ethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11713150 |
| Molecular Formula | C25H30O7S2 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | propan-2-yl (2S,4R,5R,6R)-4-acetyloxy-5-hydroxy-6-[(1R)-1-hydroxy-2,2-bis(phenylsulfanyl)ethyl]oxane-2-carboxylate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C(=O)OC(C)C)O[C@@H]([C@@H](O)C(Sc2ccccc2)Sc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C25H30O7S2/c1-15(2)30-24(29)20-14-19(31-16(3)26)21(27)23(32-20)22(28)25(33-17-10-6-4-7-11-17)34-18-12-8-5-9-13-18/h4-13,15,19-23,25,27-28H,14H2,1-3H3/t19-,20+,21-,22-,23-/m1/s1 |
| InChIKey | FPAFYBIISRAFQL-PFDCGNQRSA-N |
| XLogP | 3.66 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|