C52H70N6O5Si2 — CID 10677234
(4R,5R,6R)-4-benzyl-5-(oxan-2-yloxy)-6-(2-phenylethyl)-1,3-bis[[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]methyl]-1,3-diazinan-2-one (PubChem CID 10677234) has the molecular formula C52H70N6O5Si2 and a molecular weight of 915.34 g/mol. Its IUPAC name is (4R,5R,6R)-4-benzyl-5-(oxan-2-yloxy)-6-(2-phenylethyl)-1,3-bis[[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]methyl]-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6R)-4-benzyl-5-(oxan-2-yloxy)-6-(2-phenylethyl)-1,3-bis[[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]methyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 10677234 |
| Molecular Formula | C52H70N6O5Si2 |
| Molecular Weight | 915.34 g/mol |
| Exact Mass | 914.49 |
| IUPAC Name | (4R,5R,6R)-4-benzyl-5-(oxan-2-yloxy)-6-(2-phenylethyl)-1,3-bis[[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]methyl]-1,3-diazinan-2-one |
| SMILES | C[Si](C)(C)CCOCn1ncc2cc(CN3C(=O)N(Cc4ccc5c(cnn5COCC[Si](C)(C)C)c4)[C@H](Cc4ccccc4)[C@H](OC4CCCCO4)[C@H]3CCc3ccccc3)ccc21 |
| InChI | InChI=1S/C52H70N6O5Si2/c1-64(2,3)29-27-60-38-57-46-23-21-42(31-44(46)34-53-57)36-55-48(25-20-40-15-9-7-10-16-40)51(63-50-19-13-14-26-62-50)49(33-41-17-11-8-12-18-41)56(52(55)59)37-43-22-24-47-45(32-43)35-54-58(47)39-61-28-30-65(4,5)6/h7-12,15-18,21-24,31-32,34-35,48-51H,13-14,19-20,25-30,33,36-39H2,1-6H3/t48-,49-,50?,51-/m1/s1 |
| InChIKey | JWQAMDSIPHWPAK-VFRKINNMSA-N |
| XLogP | 10.97 |
| TPSA | 96.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.34 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|