C20H23N — CID 106778024
7-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106778024) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 7-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106778024 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 7-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CCCC2Cc1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C20H23N/c1-2-9-19-16(5-1)6-3-7-18(19)13-15-10-11-17-8-4-12-21-20(17)14-15/h1-2,5,9-11,14,18,21H,3-4,6-8,12-13H2 |
| InChIKey | RMBZJGSJCLCIDC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |