C9H12F3NO3S — CID 106782166
1,1-dimethoxy-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 106782166) has the molecular formula C9H12F3NO3S and a molecular weight of 271.26 g/mol. Its IUPAC name is 1,1-dimethoxy-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-2-ol.
| Compound Name | 1,1-dimethoxy-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 106782166 |
| Molecular Formula | C9H12F3NO3S |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1,1-dimethoxy-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | COC(OC)C(C)(O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H12F3NO3S/c1-8(14,7(15-2)16-3)5-4-13-6(17-5)9(10,11)12/h4,7,14H,1-3H3 |
| InChIKey | VHYQMZBEPQOPNQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|