C12H7Cl2F4NOS — CID 106781987
1-(2,4-dichloro-5-fluorophenyl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanol (PubChem CID 106781987) has the molecular formula C12H7Cl2F4NOS and a molecular weight of 360.16 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 106781987 |
| Molecular Formula | C12H7Cl2F4NOS |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)(c1cnc(C(F)(F)F)s1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl2F4NOS/c1-11(20,5-2-8(15)7(14)3-6(5)13)9-4-19-10(21-9)12(16,17)18/h2-4,20H,1H3 |
| InChIKey | MRHXADLNLWCZKP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|