C10H12F3NO3S — CID 106782577
2,2-diethoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 106782577) has the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. Its IUPAC name is 2,2-diethoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 2,2-diethoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 106782577 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2,2-diethoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CCOC(OCC)C(=O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H12F3NO3S/c1-3-16-8(17-4-2)7(15)6-5-14-9(18-6)10(11,12)13/h5,8H,3-4H2,1-2H3 |
| InChIKey | WCHHQHWSUSWHMX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|