C8H8F3NO3S — CID 106782576
2,2-dimethoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 106782576) has the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. Its IUPAC name is 2,2-dimethoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 2,2-dimethoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 106782576 |
| Molecular Formula | C8H8F3NO3S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 2,2-dimethoxy-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | COC(OC)C(=O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H8F3NO3S/c1-14-6(15-2)5(13)4-3-12-7(16-4)8(9,10)11/h3,6H,1-2H3 |
| InChIKey | VLKOWOAUXCRFTG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|