C8H8F3NOS — CID 106784126
2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanal (PubChem CID 106784126) has the molecular formula C8H8F3NOS and a molecular weight of 223.22 g/mol. Its IUPAC name is 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanal.
| Compound Name | 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanal |
|---|---|
| PubChem CID | 106784126 |
| Molecular Formula | C8H8F3NOS |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanal |
| SMILES | CC(C=O)Cc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H8F3NOS/c1-5(4-13)2-6-3-12-7(14-6)8(9,10)11/h3-5H,2H2,1H3 |
| InChIKey | HVSRZJMRFSSVJH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|