C16H27N3O2 — CID 106804259
5-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2-(propan-2-ylamino)pentanenitrile (PubChem CID 106804259) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 5-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2-(propan-2-ylamino)pentanenitrile.
| Compound Name | 5-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2-(propan-2-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 106804259 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 5-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2-(propan-2-ylamino)pentanenitrile |
| SMILES | CCC(C#N)(CCCN1C(=O)CC(C)(C)C1=O)NC(C)C |
| InChI | InChI=1S/C16H27N3O2/c1-6-16(11-17,18-12(2)3)8-7-9-19-13(20)10-15(4,5)14(19)21/h12,18H,6-10H2,1-5H3 |
| InChIKey | JHQPCZJCKNPYIY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|