C20H36N2O3 — CID 155439881
4-(3-ethyl-3-methyl-2,5-dioxopyrrolidin-1-yl)-2,2,4-trimethyl-N-(3-methylbutan-2-yl)pentanamide (PubChem CID 155439881) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 4-(3-ethyl-3-methyl-2,5-dioxopyrrolidin-1-yl)-2,2,4-trimethyl-N-(3-methylbutan-2-yl)pentanamide.
| Compound Name | 4-(3-ethyl-3-methyl-2,5-dioxopyrrolidin-1-yl)-2,2,4-trimethyl-N-(3-methylbutan-2-yl)pentanamide |
|---|---|
| PubChem CID | 155439881 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 4-(3-ethyl-3-methyl-2,5-dioxopyrrolidin-1-yl)-2,2,4-trimethyl-N-(3-methylbutan-2-yl)pentanamide |
| SMILES | CCC1(C)CC(=O)N(C(C)(C)CC(C)(C)C(=O)NC(C)C(C)C)C1=O |
| InChI | InChI=1S/C20H36N2O3/c1-10-20(9)11-15(23)22(17(20)25)19(7,8)12-18(5,6)16(24)21-14(4)13(2)3/h13-14H,10-12H2,1-9H3,(H,21,24) |
| InChIKey | MPAWPWMCXINAHM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|