C14H24N4S — CID 106805102
2-ethyl-5-(1-methylimidazol-2-yl)sulfanyl-2-(propan-2-ylamino)pentanenitrile (PubChem CID 106805102) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-ethyl-5-(1-methylimidazol-2-yl)sulfanyl-2-(propan-2-ylamino)pentanenitrile.
| Compound Name | 2-ethyl-5-(1-methylimidazol-2-yl)sulfanyl-2-(propan-2-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 106805102 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-ethyl-5-(1-methylimidazol-2-yl)sulfanyl-2-(propan-2-ylamino)pentanenitrile |
| SMILES | CCC(C#N)(CCCSc1nccn1C)NC(C)C |
| InChI | InChI=1S/C14H24N4S/c1-5-14(11-15,17-12(2)3)7-6-10-19-13-16-8-9-18(13)4/h8-9,12,17H,5-7,10H2,1-4H3 |
| InChIKey | LYMJVQDCUGZREI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|