C10H9NO3S — CID 10680599
methyl 5-(1,3-thiazol-2-ylmethyl)furan-2-carboxylate (PubChem CID 10680599) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is methyl 5-(1,3-thiazol-2-ylmethyl)furan-2-carboxylate.
| Compound Name | methyl 5-(1,3-thiazol-2-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 10680599 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | methyl 5-(1,3-thiazol-2-ylmethyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cc2nccs2)o1 |
| InChI | InChI=1S/C10H9NO3S/c1-13-10(12)8-3-2-7(14-8)6-9-11-4-5-15-9/h2-5H,6H2,1H3 |
| InChIKey | ZXJYGORXKMRVNQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |