C10H11ClO4 — CID 10681002
methyl 5-carbonochloridoyl-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylate (PubChem CID 10681002) has the molecular formula C10H11ClO4 and a molecular weight of 230.65 g/mol. Its IUPAC name is methyl 5-carbonochloridoyl-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | methyl 5-carbonochloridoyl-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 10681002 |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | methyl 5-carbonochloridoyl-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylate |
| SMILES | C=C(C)C1CC(C(=O)OC)=C(C(=O)Cl)O1 |
| InChI | InChI=1S/C10H11ClO4/c1-5(2)7-4-6(10(13)14-3)8(15-7)9(11)12/h7H,1,4H2,2-3H3 |
| InChIKey | PASZRIUTZSXGMA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|