C11H13ClO4 — CID 10681772
ethyl 5-carbonochloridoyl-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylate (PubChem CID 10681772) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is ethyl 5-carbonochloridoyl-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | ethyl 5-carbonochloridoyl-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 10681772 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | ethyl 5-carbonochloridoyl-2-prop-1-en-2-yl-2,3-dihydrofuran-4-carboxylate |
| SMILES | C=C(C)C1CC(C(=O)OCC)=C(C(=O)Cl)O1 |
| InChI | InChI=1S/C11H13ClO4/c1-4-15-11(14)7-5-8(6(2)3)16-9(7)10(12)13/h8H,2,4-5H2,1,3H3 |
| InChIKey | XWHWCLITZZLIBM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|