C17H33NO2 — CID 106810648
2-amino-2-ethyl-5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pentan-1-ol (PubChem CID 106810648) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pentan-1-ol.
| Compound Name | 2-amino-2-ethyl-5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pentan-1-ol |
|---|---|
| PubChem CID | 106810648 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 2-amino-2-ethyl-5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pentan-1-ol |
| SMILES | CCC(N)(CO)CCCOC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C17H33NO2/c1-5-17(18,12-19)8-6-10-20-14-11-13-7-9-16(14,4)15(13,2)3/h13-14,19H,5-12,18H2,1-4H3 |
| InChIKey | ICJOMOJVMZNJFO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|