C16H18N2 — CID 10681416
(Z)-1-phenyl-2-(2,3,4,5-tetrahydropyridin-6-yl)pent-1-en-4-yn-1-amine (PubChem CID 10681416) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (Z)-1-phenyl-2-(2,3,4,5-tetrahydropyridin-6-yl)pent-1-en-4-yn-1-amine.
| Compound Name | (Z)-1-phenyl-2-(2,3,4,5-tetrahydropyridin-6-yl)pent-1-en-4-yn-1-amine |
|---|---|
| PubChem CID | 10681416 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (Z)-1-phenyl-2-(2,3,4,5-tetrahydropyridin-6-yl)pent-1-en-4-yn-1-amine |
| SMILES | C#CC/C(C1=NCCCC1)=C(/N)c1ccccc1 |
| InChI | InChI=1S/C16H18N2/c1-2-8-14(15-11-6-7-12-18-15)16(17)13-9-4-3-5-10-13/h1,3-5,9-10H,6-8,11-12,17H2/b16-14- |
| InChIKey | PXIBXYFFXWBSPF-PEZBUJJGSA-N |
| XLogP | 3.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|