C14H14Cl2N2Pt — CID 88758515
dichloroplatinum;1,2-diphenylethene-1,2-diamine (PubChem CID 88758515) has the molecular formula C14H14Cl2N2Pt and a molecular weight of 476.26 g/mol. Its IUPAC name is dichloroplatinum;1,2-diphenylethene-1,2-diamine.
| Compound Name | dichloroplatinum;1,2-diphenylethene-1,2-diamine |
|---|---|
| PubChem CID | 88758515 |
| Molecular Formula | C14H14Cl2N2Pt |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | dichloroplatinum;1,2-diphenylethene-1,2-diamine |
| SMILES | Cl[Pt]Cl.NC(=C(N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2.2ClH.Pt/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;;;/h1-10H,15-16H2;2*1H;/q;;;+2/p-2 |
| InChIKey | PUBCILHXDBOOMS-UHFFFAOYSA-L |
| XLogP | 3.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|