C10H14N2 — CID 145093299
(Z)-2-N-methyl-1-phenylprop-1-ene-1,2-diamine (PubChem CID 145093299) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (Z)-2-N-methyl-1-phenylprop-1-ene-1,2-diamine.
| Compound Name | (Z)-2-N-methyl-1-phenylprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 145093299 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (Z)-2-N-methyl-1-phenylprop-1-ene-1,2-diamine |
| SMILES | CN/C(C)=C(\N)c1ccccc1 |
| InChI | InChI=1S/C10H14N2/c1-8(12-2)10(11)9-6-4-3-5-7-9/h3-7,12H,11H2,1-2H3/b10-8- |
| InChIKey | YZIOXVVQGYUSDR-NTMALXAHSA-N |
| XLogP | 1.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |