C11H14ClN3 — CID 146851550
2-chloro-3-methylimino-1-phenylbut-1-ene-1,4-diamine (PubChem CID 146851550) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 2-chloro-3-methylimino-1-phenylbut-1-ene-1,4-diamine.
| Compound Name | 2-chloro-3-methylimino-1-phenylbut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 146851550 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-chloro-3-methylimino-1-phenylbut-1-ene-1,4-diamine |
| SMILES | C/N=C(\CN)C(Cl)=C(N)c1ccccc1 |
| InChI | InChI=1S/C11H14ClN3/c1-15-9(7-13)10(12)11(14)8-5-3-2-4-6-8/h2-6H,7,13-14H2,1H3/b11-10?,15-9+ |
| InChIKey | BHZUOGLRIQDZMK-SGSGYMQLSA-N |
| XLogP | 1.58 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|