C18H18N2 — CID 106821096
6-methyl-2-phenyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 106821096) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-methyl-2-phenyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 6-methyl-2-phenyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 106821096 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-methyl-2-phenyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1cccc2c3c([nH]c12)CCN(c1ccccc1)C3 |
| InChI | InChI=1S/C18H18N2/c1-13-6-5-9-15-16-12-20(14-7-3-2-4-8-14)11-10-17(16)19-18(13)15/h2-9,19H,10-12H2,1H3 |
| InChIKey | PUMHULQOMQVWRB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|