C18H20N2OS — CID 51586804
(1R)-2-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-1-thiophen-2-ylethanol (PubChem CID 51586804) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is (1R)-2-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-1-thiophen-2-ylethanol.
| Compound Name | (1R)-2-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 51586804 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (1R)-2-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-1-thiophen-2-ylethanol |
| SMILES | Cc1cccc2c3c([nH]c12)CCN(C[C@@H](O)c1cccs1)C3 |
| InChI | InChI=1S/C18H20N2OS/c1-12-4-2-5-13-14-10-20(8-7-15(14)19-18(12)13)11-16(21)17-6-3-9-22-17/h2-6,9,16,19,21H,7-8,10-11H2,1H3/t16-/m1/s1 |
| InChIKey | OYRKXBJTODMRPL-MRXNPFEDSA-N |
| XLogP | 3.63 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|