C17H24O4 — CID 106826594
(1-methylcyclohexyl)-(2,3,4-trimethoxyphenyl)methanone (PubChem CID 106826594) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1-methylcyclohexyl)-(2,3,4-trimethoxyphenyl)methanone.
| Compound Name | (1-methylcyclohexyl)-(2,3,4-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 106826594 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1-methylcyclohexyl)-(2,3,4-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2(C)CCCCC2)c(OC)c1OC |
| InChI | InChI=1S/C17H24O4/c1-17(10-6-5-7-11-17)16(18)12-8-9-13(19-2)15(21-4)14(12)20-3/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | WXDJTHKPCWWSRO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |