C8H14F3NO3S — CID 106837140
1-[1-(trifluoromethylsulfonyl)piperidin-4-yl]ethanol (PubChem CID 106837140) has the molecular formula C8H14F3NO3S and a molecular weight of 261.26 g/mol. Its IUPAC name is 1-[1-(trifluoromethylsulfonyl)piperidin-4-yl]ethanol.
| Compound Name | 1-[1-(trifluoromethylsulfonyl)piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 106837140 |
| Molecular Formula | C8H14F3NO3S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-[1-(trifluoromethylsulfonyl)piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H14F3NO3S/c1-6(13)7-2-4-12(5-3-7)16(14,15)8(9,10)11/h6-7,13H,2-5H2,1H3 |
| InChIKey | CPUMYCHEDYGNAT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |