C14H22O4Si — CID 10684325
[[(1E)-buta-1,3-dienyl]-methyl-(prop-2-enoyloxymethyl)silyl]methyl 2-methylpropanoate (PubChem CID 10684325) has the molecular formula C14H22O4Si and a molecular weight of 282.41 g/mol. Its IUPAC name is [[(1E)-buta-1,3-dienyl]-methyl-(prop-2-enoyloxymethyl)silyl]methyl 2-methylpropanoate.
| Compound Name | [[(1E)-buta-1,3-dienyl]-methyl-(prop-2-enoyloxymethyl)silyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 10684325 |
| Molecular Formula | C14H22O4Si |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [[(1E)-buta-1,3-dienyl]-methyl-(prop-2-enoyloxymethyl)silyl]methyl 2-methylpropanoate |
| SMILES | C=C/C=C/[Si](C)(COC(=O)C=C)COC(=O)C(C)C |
| InChI | InChI=1S/C14H22O4Si/c1-6-8-9-19(5,10-17-13(15)7-2)11-18-14(16)12(3)4/h6-9,12H,1-2,10-11H2,3-5H3/b9-8+ |
| InChIKey | KDVPWCZXLAUYOS-CMDGGOBGSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|