C18H22O4Si — CID 10496672
[[(1E)-buta-1,3-dienyl]-methyl-[(2-phenylacetyl)oxymethyl]silyl]methyl prop-2-enoate (PubChem CID 10496672) has the molecular formula C18H22O4Si and a molecular weight of 330.46 g/mol. Its IUPAC name is [[(1E)-buta-1,3-dienyl]-methyl-[(2-phenylacetyl)oxymethyl]silyl]methyl prop-2-enoate.
| Compound Name | [[(1E)-buta-1,3-dienyl]-methyl-[(2-phenylacetyl)oxymethyl]silyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 10496672 |
| Molecular Formula | C18H22O4Si |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [[(1E)-buta-1,3-dienyl]-methyl-[(2-phenylacetyl)oxymethyl]silyl]methyl prop-2-enoate |
| SMILES | C=C/C=C/[Si](C)(COC(=O)C=C)COC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H22O4Si/c1-4-6-12-23(3,14-21-17(19)5-2)15-22-18(20)13-16-10-8-7-9-11-16/h4-12H,1-2,13-15H2,3H3/b12-6+ |
| InChIKey | XYTADNDHAXVRJA-WUXMJOGZSA-N |
| XLogP | 2.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|