C16H28O4 — CID 10684486
ethyl (E)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]non-8-enoate (PubChem CID 10684486) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl (E)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]non-8-enoate.
| Compound Name | ethyl (E)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]non-8-enoate |
|---|---|
| PubChem CID | 10684486 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethyl (E)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]non-8-enoate |
| SMILES | CCOC(=O)CCCCCC/C=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H28O4/c1-4-18-15(17)12-10-8-6-5-7-9-11-14-13-19-16(2,3)20-14/h9,11,14H,4-8,10,12-13H2,1-3H3/b11-9+/t14-/m0/s1 |
| InChIKey | UZPDPXHMXOHWAP-MARXPDLDSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|