C21H29FO5 — CID 145011372
fluoro 4-[2-oxo-5-[(1E,3E,5Z,7E)-tetradeca-1,3,5,7-tetraenyl]-1,3-dioxolan-4-yl]butanoate (PubChem CID 145011372) has the molecular formula C21H29FO5 and a molecular weight of 380.46 g/mol. Its IUPAC name is fluoro 4-[2-oxo-5-[(1E,3E,5Z,7E)-tetradeca-1,3,5,7-tetraenyl]-1,3-dioxolan-4-yl]butanoate.
| Compound Name | fluoro 4-[2-oxo-5-[(1E,3E,5Z,7E)-tetradeca-1,3,5,7-tetraenyl]-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 145011372 |
| Molecular Formula | C21H29FO5 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | fluoro 4-[2-oxo-5-[(1E,3E,5Z,7E)-tetradeca-1,3,5,7-tetraenyl]-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCCCCC/C=C/C=C\C=C\C=C\C1OC(=O)OC1CCCC(=O)OF |
| InChI | InChI=1S/C21H29FO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-19(26-21(24)25-18)16-14-17-20(23)27-22/h7-13,15,18-19H,2-6,14,16-17H2,1H3/b8-7+,10-9-,12-11+,15-13+ |
| InChIKey | TVVOIMRVYZLLKT-XIKASTMESA-N |
| XLogP | 5.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|