C16H22O4 — CID 11265912
methyl 4-[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate (PubChem CID 11265912) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 4-[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate.
| Compound Name | methyl 4-[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 11265912 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | methyl 4-[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
| SMILES | C#C/C=C/C=C/[C@H]1OC(C)(C)O[C@H]1CCCC(=O)OC |
| InChI | InChI=1S/C16H22O4/c1-5-6-7-8-10-13-14(20-16(2,3)19-13)11-9-12-15(17)18-4/h1,6-8,10,13-14H,9,11-12H2,2-4H3/b7-6+,10-8+/t13-,14+/m1/s1 |
| InChIKey | ZYSVOLUMQCHYEM-FOASLXJTSA-N |
| XLogP | 2.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|