C15H20BrNO4 — CID 106853558
2-bromo-N,N-bis(oxolan-2-ylmethyl)furan-3-carboxamide (PubChem CID 106853558) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is 2-bromo-N,N-bis(oxolan-2-ylmethyl)furan-3-carboxamide.
| Compound Name | 2-bromo-N,N-bis(oxolan-2-ylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106853558 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-bromo-N,N-bis(oxolan-2-ylmethyl)furan-3-carboxamide |
| SMILES | O=C(c1ccoc1Br)N(CC1CCCO1)CC1CCCO1 |
| InChI | InChI=1S/C15H20BrNO4/c16-14-13(5-8-21-14)15(18)17(9-11-3-1-6-19-11)10-12-4-2-7-20-12/h5,8,11-12H,1-4,6-7,9-10H2 |
| InChIKey | BUCXYOCXWBNMEN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |