C13H6Cl2N2O2S — CID 10687474
2-(3,5-dichlorophenyl)sulfanyl-6-nitrobenzonitrile (PubChem CID 10687474) has the molecular formula C13H6Cl2N2O2S and a molecular weight of 325.18 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)sulfanyl-6-nitrobenzonitrile.
| Compound Name | 2-(3,5-dichlorophenyl)sulfanyl-6-nitrobenzonitrile |
|---|---|
| PubChem CID | 10687474 |
| Molecular Formula | C13H6Cl2N2O2S |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | 2-(3,5-dichlorophenyl)sulfanyl-6-nitrobenzonitrile |
| SMILES | N#Cc1c(Sc2cc(Cl)cc(Cl)c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H6Cl2N2O2S/c14-8-4-9(15)6-10(5-8)20-13-3-1-2-12(17(18)19)11(13)7-16/h1-6H |
| InChIKey | SXLRTBABQDNJLS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|