C20H29NOSi — CID 10687684
[(1S,2S,3S)-2-phenyl-3-[(E)-2-trimethylsilylethenyl]cyclopropyl]-piperidin-1-ylmethanone (PubChem CID 10687684) has the molecular formula C20H29NOSi and a molecular weight of 327.54 g/mol. Its IUPAC name is [(1S,2S,3S)-2-phenyl-3-[(E)-2-trimethylsilylethenyl]cyclopropyl]-piperidin-1-ylmethanone.
| Compound Name | [(1S,2S,3S)-2-phenyl-3-[(E)-2-trimethylsilylethenyl]cyclopropyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 10687684 |
| Molecular Formula | C20H29NOSi |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | [(1S,2S,3S)-2-phenyl-3-[(E)-2-trimethylsilylethenyl]cyclopropyl]-piperidin-1-ylmethanone |
| SMILES | C[Si](C)(C)/C=C/[C@@H]1[C@H](C(=O)N2CCCCC2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H29NOSi/c1-23(2,3)15-12-17-18(16-10-6-4-7-11-16)19(17)20(22)21-13-8-5-9-14-21/h4,6-7,10-12,15,17-19H,5,8-9,13-14H2,1-3H3/b15-12+/t17-,18-,19-/m0/s1 |
| InChIKey | ZEUQVIKYHUNQSP-CPBXXRDBSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|