C3H12O10P4 — CID 10687978
Tris(dihydroxyphosphinylmethyl)phosphine oxide (PubChem CID 10687978) has the molecular formula C3H12O10P4 and a molecular weight of 332.02 g/mol. Its IUPAC name is bis(phosphonomethyl)phosphorylmethylphosphonic acid.
| Compound Name | Tris(dihydroxyphosphinylmethyl)phosphine oxide |
|---|---|
| PubChem CID | 10687978 |
| Molecular Formula | C3H12O10P4 |
| Molecular Weight | 332.02 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | bis(phosphonomethyl)phosphorylmethylphosphonic acid |
| SMILES | C(P(=O)(CP(=O)(O)O)CP(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C3H12O10P4/c4-14(1-15(5,6)7,2-16(8,9)10)3-17(11,12)13/h1-3H2,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13) |
| InChIKey | DABPUAVPEOJXHB-UHFFFAOYSA-N |
| XLogP | -5.80 |
| TPSA | 190.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 382 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.02 |
| LogP ≤ 5 | -5.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|