C14H20BrF — CID 106880046
2-(1-bromo-3,3-dimethylbutyl)-5-fluoro-1,3-dimethylbenzene (PubChem CID 106880046) has the molecular formula C14H20BrF and a molecular weight of 287.22 g/mol. Its IUPAC name is 2-(1-bromo-3,3-dimethylbutyl)-5-fluoro-1,3-dimethylbenzene.
| Compound Name | 2-(1-bromo-3,3-dimethylbutyl)-5-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 106880046 |
| Molecular Formula | C14H20BrF |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-(1-bromo-3,3-dimethylbutyl)-5-fluoro-1,3-dimethylbenzene |
| SMILES | Cc1cc(F)cc(C)c1C(Br)CC(C)(C)C |
| InChI | InChI=1S/C14H20BrF/c1-9-6-11(16)7-10(2)13(9)12(15)8-14(3,4)5/h6-7,12H,8H2,1-5H3 |
| InChIKey | YJQDZGSKMAEHRP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|