C13H13FN2S — CID 106884676
4-(2-fluoro-4,6-dimethylphenyl)-6-methyl-1H-pyrimidine-2-thione (PubChem CID 106884676) has the molecular formula C13H13FN2S and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(2-fluoro-4,6-dimethylphenyl)-6-methyl-1H-pyrimidine-2-thione.
| Compound Name | 4-(2-fluoro-4,6-dimethylphenyl)-6-methyl-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 106884676 |
| Molecular Formula | C13H13FN2S |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-(2-fluoro-4,6-dimethylphenyl)-6-methyl-1H-pyrimidine-2-thione |
| SMILES | Cc1cc(C)c(-c2cc(C)[nH]c(=S)n2)c(F)c1 |
| InChI | InChI=1S/C13H13FN2S/c1-7-4-8(2)12(10(14)5-7)11-6-9(3)15-13(17)16-11/h4-6H,1-3H3,(H,15,16,17) |
| InChIKey | NJXGEPNTARAYEF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|