C14H15FN2O — CID 106884690
3-(2-fluoro-4,6-dimethylphenyl)-5,6-dimethyl-1H-pyrazin-2-one (PubChem CID 106884690) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is 3-(2-fluoro-4,6-dimethylphenyl)-5,6-dimethyl-1H-pyrazin-2-one.
| Compound Name | 3-(2-fluoro-4,6-dimethylphenyl)-5,6-dimethyl-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 106884690 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-(2-fluoro-4,6-dimethylphenyl)-5,6-dimethyl-1H-pyrazin-2-one |
| SMILES | Cc1cc(C)c(-c2nc(C)c(C)[nH]c2=O)c(F)c1 |
| InChI | InChI=1S/C14H15FN2O/c1-7-5-8(2)12(11(15)6-7)13-14(18)17-10(4)9(3)16-13/h5-6H,1-4H3,(H,17,18) |
| InChIKey | QVMDLFNCTBTZGC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |